mirror of
https://github.com/antoniomika/sish.git
synced 2025-12-24 13:37:57 +08:00
451 lines
11 KiB
Go
451 lines
11 KiB
Go
package utils
|
|
|
|
import (
|
|
"encoding/base64"
|
|
"fmt"
|
|
"log"
|
|
"net/http"
|
|
"strings"
|
|
"sync"
|
|
|
|
"github.com/gin-gonic/gin"
|
|
"github.com/gorilla/websocket"
|
|
"github.com/spf13/viper"
|
|
)
|
|
|
|
// upgrader is the default WS upgrader that we use for webconsole clients.
|
|
var upgrader = websocket.Upgrader{
|
|
ReadBufferSize: 1024,
|
|
WriteBufferSize: 1024,
|
|
}
|
|
|
|
// WebClient represents a primitive web console client. It maintains
|
|
// references that allow us to communicate and track a client connection.
|
|
type WebClient struct {
|
|
Conn *websocket.Conn
|
|
Console *WebConsole
|
|
Send chan []byte
|
|
Route string
|
|
}
|
|
|
|
// WebConsole represents the data structure that stores web console client information.
|
|
// Clients is a map[string][]*WebClient.
|
|
// RouteTokens is a map[string]string.
|
|
type WebConsole struct {
|
|
Clients *sync.Map
|
|
RouteTokens *sync.Map
|
|
State *State
|
|
}
|
|
|
|
// NewWebConsole sets up the WebConsole.
|
|
func NewWebConsole() *WebConsole {
|
|
return &WebConsole{
|
|
Clients: &sync.Map{},
|
|
RouteTokens: &sync.Map{},
|
|
}
|
|
}
|
|
|
|
// HandleRequest handles an incoming web request, handles auth, and then routes it.
|
|
func (c *WebConsole) HandleRequest(hostname string, hostIsRoot bool, g *gin.Context) {
|
|
userAuthed := false
|
|
userIsAdmin := false
|
|
if (viper.GetBool("admin-console") && viper.GetString("admin-console-token") != "") && (g.Request.URL.Query().Get("x-authorization") == viper.GetString("admin-console-token") || g.Request.Header.Get("x-authorization") == viper.GetString("admin-console-token")) {
|
|
userIsAdmin = true
|
|
userAuthed = true
|
|
}
|
|
|
|
tokenInterface, ok := c.RouteTokens.Load(hostname)
|
|
if ok {
|
|
routeToken, ok := tokenInterface.(string)
|
|
if viper.GetBool("service-console") && ok && (g.Request.URL.Query().Get("x-authorization") == routeToken || g.Request.Header.Get("x-authorization") == routeToken) {
|
|
userAuthed = true
|
|
}
|
|
}
|
|
|
|
if strings.HasPrefix(g.Request.URL.Path, "/_sish/console/ws") && userAuthed {
|
|
c.HandleWebSocket(hostname, g)
|
|
return
|
|
} else if strings.HasPrefix(g.Request.URL.Path, "/_sish/console") && userAuthed {
|
|
c.HandleTemplate(hostname, hostIsRoot, userIsAdmin, g)
|
|
return
|
|
} else if strings.HasPrefix(g.Request.URL.Path, "/_sish/api/disconnectclient/") && userIsAdmin {
|
|
c.HandleDisconnectClient(hostname, g)
|
|
return
|
|
} else if strings.HasPrefix(g.Request.URL.Path, "/_sish/api/disconnectroute/") && userIsAdmin {
|
|
c.HandleDisconnectRoute(hostname, g)
|
|
return
|
|
} else if strings.HasPrefix(g.Request.URL.Path, "/_sish/api/clients") && hostIsRoot && userIsAdmin {
|
|
c.HandleClients(hostname, g)
|
|
return
|
|
}
|
|
}
|
|
|
|
// HandleTemplate handles rendering the console templates.
|
|
func (c *WebConsole) HandleTemplate(hostname string, hostIsRoot bool, userIsAdmin bool, g *gin.Context) {
|
|
if hostIsRoot && userIsAdmin {
|
|
g.HTML(http.StatusOK, "routes", nil)
|
|
return
|
|
}
|
|
|
|
if c.RouteExists(hostname) {
|
|
g.HTML(http.StatusOK, "console", nil)
|
|
return
|
|
}
|
|
|
|
err := g.AbortWithError(http.StatusNotFound, fmt.Errorf("cannot find connection for host: %s", hostname))
|
|
if err != nil {
|
|
log.Println("Aborting with error", err)
|
|
}
|
|
}
|
|
|
|
// HandleWebSocket handles the websocket route
|
|
func (c *WebConsole) HandleWebSocket(hostname string, g *gin.Context) {
|
|
conn, err := upgrader.Upgrade(g.Writer, g.Request, nil)
|
|
if err != nil {
|
|
log.Println(err)
|
|
return
|
|
}
|
|
|
|
client := &WebClient{
|
|
Conn: conn,
|
|
Console: c,
|
|
Send: make(chan []byte),
|
|
Route: hostname,
|
|
}
|
|
|
|
c.AddClient(hostname, client)
|
|
|
|
go client.Handle()
|
|
}
|
|
|
|
// HandleDisconnectClient handles the disconnection request for a SSH client.
|
|
func (c *WebConsole) HandleDisconnectClient(hostname string, g *gin.Context) {
|
|
client := strings.TrimPrefix(g.Request.URL.Path, "/_sish/api/disconnectclient/")
|
|
|
|
c.State.SSHConnections.Range(func(key interface{}, val interface{}) bool {
|
|
clientName := key.(string)
|
|
|
|
if clientName == client {
|
|
holderConn := val.(*SSHConnection)
|
|
holderConn.CleanUp(c.State)
|
|
|
|
return false
|
|
}
|
|
|
|
return true
|
|
})
|
|
|
|
data := map[string]interface{}{
|
|
"status": true,
|
|
}
|
|
|
|
g.JSON(http.StatusOK, data)
|
|
}
|
|
|
|
// HandleDisconnectRoute handles the disconnection request for a forwarded route.
|
|
func (c *WebConsole) HandleDisconnectRoute(hostname string, g *gin.Context) {
|
|
route := strings.Split(strings.TrimPrefix(g.Request.URL.Path, "/_sish/api/disconnectroute/"), "/")
|
|
encRouteName := route[1]
|
|
|
|
decRouteName, err := base64.StdEncoding.DecodeString(encRouteName)
|
|
if err != nil {
|
|
log.Println("Error decoding route name:", err)
|
|
err := g.AbortWithError(http.StatusInternalServerError, err)
|
|
|
|
if err != nil {
|
|
log.Println("Error aborting with error:", err)
|
|
}
|
|
return
|
|
}
|
|
|
|
routeName := string(decRouteName)
|
|
|
|
listenerTmp, ok := c.State.Listeners.Load(routeName)
|
|
if ok {
|
|
listener, ok := listenerTmp.(*ListenerHolder)
|
|
|
|
if ok {
|
|
listener.Close()
|
|
}
|
|
}
|
|
|
|
data := map[string]interface{}{
|
|
"status": true,
|
|
}
|
|
|
|
g.JSON(http.StatusOK, data)
|
|
}
|
|
|
|
// HandleClients handles returning all connected SSH clients. This will
|
|
// also go through all of the forwarded connections for the SSH client and
|
|
// return them.
|
|
func (c *WebConsole) HandleClients(hostname string, g *gin.Context) {
|
|
data := map[string]interface{}{
|
|
"status": true,
|
|
}
|
|
|
|
clients := map[string]map[string]interface{}{}
|
|
c.State.SSHConnections.Range(func(key interface{}, val interface{}) bool {
|
|
clientName := key.(string)
|
|
sshConn := val.(*SSHConnection)
|
|
|
|
listeners := []string{}
|
|
routeListeners := map[string]map[string]interface{}{}
|
|
|
|
sshConn.Listeners.Range(func(key interface{}, val interface{}) bool {
|
|
name, ok := key.(string)
|
|
|
|
if ok {
|
|
listeners = append(listeners, name)
|
|
}
|
|
|
|
return true
|
|
})
|
|
|
|
tcpAliases := map[string]interface{}{}
|
|
c.State.AliasListeners.Range(func(key interface{}, val interface{}) bool {
|
|
tcpAlias := key.(string)
|
|
aliasHolder := val.(*AliasHolder)
|
|
|
|
for _, v := range listeners {
|
|
for _, server := range aliasHolder.Balancer.Servers() {
|
|
serverAddr, err := base64.StdEncoding.DecodeString(server.Host)
|
|
if err != nil {
|
|
log.Println("Error decoding server host:", err)
|
|
continue
|
|
}
|
|
|
|
aliasAddress := string(serverAddr)
|
|
|
|
if v == aliasAddress {
|
|
tcpAliases[tcpAlias] = aliasAddress
|
|
}
|
|
}
|
|
}
|
|
|
|
return true
|
|
})
|
|
|
|
listenerParts := map[string]interface{}{}
|
|
c.State.TCPListeners.Range(func(key interface{}, val interface{}) bool {
|
|
tcpAlias := key.(string)
|
|
aliasHolder := val.(*TCPHolder)
|
|
|
|
for _, v := range listeners {
|
|
for _, server := range aliasHolder.Balancer.Servers() {
|
|
serverAddr, err := base64.StdEncoding.DecodeString(server.Host)
|
|
if err != nil {
|
|
log.Println("Error decoding server host:", err)
|
|
continue
|
|
}
|
|
|
|
aliasAddress := string(serverAddr)
|
|
|
|
if v == aliasAddress {
|
|
listenerParts[tcpAlias] = aliasAddress
|
|
}
|
|
}
|
|
}
|
|
|
|
return true
|
|
})
|
|
|
|
httpListeners := map[string]interface{}{}
|
|
c.State.HTTPListeners.Range(func(key interface{}, val interface{}) bool {
|
|
httpListener := key.(string)
|
|
aliasAddress := val.(*HTTPHolder)
|
|
|
|
listenerHandlers := []string{}
|
|
aliasAddress.SSHConnections.Range(func(key interface{}, val interface{}) bool {
|
|
aliasAddr := key.(string)
|
|
|
|
for _, v := range listeners {
|
|
if v == aliasAddr {
|
|
listenerHandlers = append(listenerHandlers, aliasAddr)
|
|
}
|
|
}
|
|
return true
|
|
})
|
|
|
|
if len(listenerHandlers) > 0 {
|
|
httpListeners[httpListener] = listenerHandlers
|
|
}
|
|
|
|
return true
|
|
})
|
|
|
|
routeListeners["tcpAliases"] = tcpAliases
|
|
routeListeners["listeners"] = listenerParts
|
|
routeListeners["httpListeners"] = httpListeners
|
|
|
|
pubKey := ""
|
|
pubKeyFingerprint := ""
|
|
if sshConn.SSHConn.Permissions != nil {
|
|
if _, ok := sshConn.SSHConn.Permissions.Extensions["pubKey"]; ok {
|
|
pubKey = sshConn.SSHConn.Permissions.Extensions["pubKey"]
|
|
pubKeyFingerprint = sshConn.SSHConn.Permissions.Extensions["pubKeyFingerprint"]
|
|
}
|
|
}
|
|
|
|
clients[clientName] = map[string]interface{}{
|
|
"remoteAddr": sshConn.SSHConn.RemoteAddr().String(),
|
|
"user": sshConn.SSHConn.User(),
|
|
"version": string(sshConn.SSHConn.ClientVersion()),
|
|
"session": sshConn.SSHConn.SessionID(),
|
|
"pubKey": pubKey,
|
|
"pubKeyFingerprint": pubKeyFingerprint,
|
|
"listeners": listeners,
|
|
"routeListeners": routeListeners,
|
|
}
|
|
|
|
return true
|
|
})
|
|
|
|
data["clients"] = clients
|
|
|
|
g.JSON(http.StatusOK, data)
|
|
}
|
|
|
|
// RouteToken returns the route token for a specific route.
|
|
func (c *WebConsole) RouteToken(route string) (string, bool) {
|
|
token, ok := c.RouteTokens.Load(route)
|
|
routeToken := ""
|
|
|
|
if ok {
|
|
routeToken = token.(string)
|
|
}
|
|
|
|
return routeToken, ok
|
|
}
|
|
|
|
// RouteExists check if a route token exists.
|
|
func (c *WebConsole) RouteExists(route string) bool {
|
|
_, ok := c.RouteToken(route)
|
|
return ok
|
|
}
|
|
|
|
// AddRoute adds a route token to the console.
|
|
func (c *WebConsole) AddRoute(route string, token string) {
|
|
c.Clients.LoadOrStore(route, []*WebClient{})
|
|
c.RouteTokens.Store(route, token)
|
|
}
|
|
|
|
// RemoveRoute removes a route token from the console.
|
|
func (c *WebConsole) RemoveRoute(route string) {
|
|
data, ok := c.Clients.Load(route)
|
|
|
|
if !ok {
|
|
return
|
|
}
|
|
|
|
clients, ok := data.([]*WebClient)
|
|
|
|
if !ok {
|
|
return
|
|
}
|
|
|
|
for _, client := range clients {
|
|
client.Conn.Close()
|
|
}
|
|
|
|
c.Clients.Delete(route)
|
|
c.RouteTokens.Delete(route)
|
|
}
|
|
|
|
// AddClient adds a client to the console route.
|
|
func (c *WebConsole) AddClient(route string, w *WebClient) {
|
|
data, ok := c.Clients.Load(route)
|
|
|
|
if !ok {
|
|
return
|
|
}
|
|
|
|
clients, ok := data.([]*WebClient)
|
|
|
|
if !ok {
|
|
return
|
|
}
|
|
|
|
clients = append(clients, w)
|
|
|
|
c.Clients.Store(route, clients)
|
|
}
|
|
|
|
// RemoveClient removes a client from the console route.
|
|
func (c *WebConsole) RemoveClient(route string, w *WebClient) {
|
|
data, ok := c.Clients.Load(route)
|
|
|
|
if !ok {
|
|
return
|
|
}
|
|
|
|
clients, ok := data.([]*WebClient)
|
|
|
|
if !ok {
|
|
return
|
|
}
|
|
|
|
found := false
|
|
toRemove := 0
|
|
for i, client := range clients {
|
|
if client == w {
|
|
found = true
|
|
toRemove = i
|
|
break
|
|
}
|
|
}
|
|
|
|
if found {
|
|
clients[toRemove] = clients[len(clients)-1]
|
|
c.Clients.Store(route, clients[:len(clients)-1])
|
|
}
|
|
}
|
|
|
|
// BroadcastRoute sends a message to all clients on a route.
|
|
func (c *WebConsole) BroadcastRoute(route string, message []byte) {
|
|
data, ok := c.Clients.Load(route)
|
|
|
|
if !ok {
|
|
return
|
|
}
|
|
|
|
clients, ok := data.([]*WebClient)
|
|
|
|
if !ok {
|
|
return
|
|
}
|
|
|
|
for _, client := range clients {
|
|
client.Send <- message
|
|
}
|
|
}
|
|
|
|
// Handle is the only place socket reads and writes happen.
|
|
func (c *WebClient) Handle() {
|
|
defer func() {
|
|
c.Conn.Close()
|
|
c.Console.RemoveClient(c.Route, c)
|
|
}()
|
|
|
|
for message := range c.Send {
|
|
w, err := c.Conn.NextWriter(websocket.TextMessage)
|
|
if err != nil {
|
|
return
|
|
}
|
|
|
|
_, err = w.Write(message)
|
|
if err != nil {
|
|
return
|
|
}
|
|
|
|
if err := w.Close(); err != nil {
|
|
return
|
|
}
|
|
}
|
|
|
|
err := c.Conn.WriteMessage(websocket.CloseMessage, []byte{})
|
|
if err != nil {
|
|
log.Println("Error writing to websocket:", err)
|
|
}
|
|
}
|